Drugs present in MMsINC which are similar to the molecule MMscode: MMs02259171
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725715 | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.74 |
MMs01725805 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.72 |
MMs01724797 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.72 |
MMs01726742 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.72 |
MMs01724759 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.72 |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.72 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.72 |