Drugs present in MMsINC which are similar to the molecule MMscode: MMs02252315
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.86 |
MMs01724845 | Brc1ccccc1C[N+](CC)(C)C | 0.85 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.84 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.81 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.81 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.79 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.78 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.77 |
MMs01725390 | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.73 |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.72 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.71 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |