Drugs present in MMsINC which are similar to the molecule MMscode: MMs02252099
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.84 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.74 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.72 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |