Drugs present in MMsINC which are similar to the molecule MMscode: MMs02250619
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.75 |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.75 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01725323![]() | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725325![]() | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725327![]() | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01724814![]() | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.72 |
MMs01724955![]() | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.72 |
MMs01725662![]() | Oc1cc(ccc1)C(O)C(N)C | 0.71 |
MMs01725664![]() | Oc1cc(ccc1)C(O)C(N)C | 0.71 |
MMs01725023![]() | Oc1cc(ccc1)C(O)C(N)C | 0.71 |
MMs01724903![]() | Oc1cc(ccc1)C(O)C(N)C | 0.71 |