Drugs present in MMsINC which are similar to the molecule MMscode: MMs02246951
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726742 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.88 |
MMs01725805 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.88 |
MMs01724797 | Clc1ccc(cc1)C(O)(C(O)(C)C)C | 0.88 |
MMs01724759 | Clc1ccc(cc1)C(O)(CC(O)(C)C)C | 0.88 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.80 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.80 |
MMs01725786 | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.73 |
MMs01724737 | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.73 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |