Drugs present in MMsINC which are similar to the molecule MMscode: MMs02237279
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.78 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.78 |
MMs01725031 | S1Cc2c(cccc2)\C(\c2c1cccc2)=C/CC[NH+](C)C | 0.74 |
MMs01725298 | [NH3+]C1CC1c1ccccc1 | 0.73 |
MMs01725446 | [NH3+]C1CC1c1ccccc1 | 0.73 |
MMs01725649 | [NH3+]C1CC1c1ccccc1 | 0.73 |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.70 |