Drugs present in MMsINC which are similar to the molecule MMscode: MMs02221896
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724851![]() | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.76 |
MMs01724935![]() | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.75 |
MMs01725656![]() | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.74 |
MMs01724853![]() | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.73 |
MMs01725799![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.73 |
MMs01725233![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.73 |
MMs01725351![]() | Clc1cc2NC(N(S(=O)(=O)c2cc1S(=O)(=O)N)C)CCl | 0.72 |
MMs01725349![]() | Clc1cc2NC(N(S(=O)(=O)c2cc1S(=O)(=O)N)C)CCl | 0.72 |
MMs01725353![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)C(Cl)Cl | 0.71 |
MMs01725355![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)C(Cl)Cl | 0.71 |