Drugs present in MMsINC which are similar to the molecule MMscode: MMs02217938
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.74 |
MMs01727243 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.74 |
MMs01726858 | Ic1cc(I)c2c(nccc2)c1O | 0.72 |
MMs01727057 | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.72 |
MMs01727059 | Clc1cc2nc(ccc2cc1)\C=C\c1cc(ccc1)C(SCC1(CC1)CC(O)=O)CCc1ccccc1C(O)(C)C | 0.72 |
MMs01724953 | OC(=O)C1CCn2c1ccc2C(=O)c1ccccc1 | 0.71 |
MMs01725010 | OC(=O)C1CCn2c1ccc2C(=O)c1ccccc1 | 0.71 |
MMs01727387 | S(=O)(=O)(Nc1ncccc1)c1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1 | 0.71 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.70 |
MMs01724835 | O1c2c(cc(cc2)C(C)C)C(=O)c2cc(C(O)=O)c(nc12)N | 0.70 |