Drugs present in MMsINC which are similar to the molecule MMscode: MMs02217927
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724812![]() | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.72 |
MMs01725319![]() | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.72 |
MMs01724832![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.71 |
MMs01725223![]() | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.70 |
MMs01725345![]() | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.70 |