Drugs present in MMsINC which are similar to the molecule MMscode: MMs02202285
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726626 | [NH2+]=C(N)c1ccc(NN=Nc2ccc(cc2)C(=[NH2+])N)cc1 | 0.74 |
MMs01725549 | [NH2+](CCCC1c2c(C=Cc3c1cccc3)cccc2)C | 0.72 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.71 |
MMs01725660 | [NH+](CC(CC1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.71 |
MMs01724949 | [NH+]=1CCNC=1C1CC1(c1ccccc1)c1ccccc1 | 0.70 |
MMs01724739 | [NH+]=1CCNC=1C1CC1(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725649 | [NH3+]C1CC1c1ccccc1 | 0.70 |
MMs01725446 | [NH3+]C1CC1c1ccccc1 | 0.70 |
MMs01725298 | [NH3+]C1CC1c1ccccc1 | 0.70 |