Drugs present in MMsINC which are similar to the molecule MMscode: MMs02199802
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.75 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.73 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.73 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.72 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |