Drugs present in MMsINC which are similar to the molecule MMscode: MMs02195255
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.80 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.80 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01727365 | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.72 |
MMs01724736 | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.70 |