Drugs present in MMsINC which are similar to the molecule MMscode: MMs02186581
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726114 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.75 |
MMs01726116 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.75 |
MMs01726118 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.75 |
MMs01726112 | Brc1[nH]c2c3c1CC1N(CC(C=C1c3ccc2)C(=O)NC1(OC2(O)N(C(CC(C)C)C(=O)N3C2CCC3)C1=O)C(C)C)C | 0.75 |
MMs01724998 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.72 |
MMs01725025 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.72 |
MMs01725605 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.72 |
MMs01726139 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.72 |
MMs01726141 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.72 |
MMs01726143 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.72 |