Drugs present in MMsINC which are similar to the molecule MMscode: MMs02183320
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727116 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.74 |
MMs01727118 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.74 |
MMs01727120 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.74 |
MMs01727122 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.74 |
MMs01727692 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CN)C(O)C(O)C2N)C(N)CC(N)C1O | 0.72 |
MMs01727694 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CN)C(O)C(O)C2N)C(N)CC(N)C1O | 0.72 |
MMs01727696 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CN)C(O)C(O)C2N)C(N)CC(N)C1O | 0.72 |
MMs01727698 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CN)C(O)C(O)C2N)C(N)CC(N)C1O | 0.72 |
MMs01727708 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CO)C(O)C(O)C2N)C(N)CC(N)C1O | 0.72 |
MMs01727710 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CO)C(O)C(O)C2N)C(N)CC(N)C1O | 0.72 |
MMs01727712 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CO)C(O)C(O)C2N)C(N)CC(N)C1O | 0.72 |
MMs01727714 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CO)C(O)C(O)C2N)C(N)CC(N)C1O | 0.72 |