Drugs present in MMsINC which are similar to the molecule MMscode: MMs02177477
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724976 | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.74 |
MMs01725157 | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.74 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.74 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.74 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.72 |