Drugs present in MMsINC which are similar to the molecule MMscode: MMs02176807
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.78 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.72 |
MMs01726088 | FC12C(C3CC(C)C(OC(=O)c4ccccc4)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.70 |
MMs01726090 | FC12C(C3CC(C)C(OC(=O)c4ccccc4)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.70 |
MMs01726091 | FC12C(C3CC(C)C(OC(=O)c4ccccc4)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.70 |
MMs01726092 | FC12C(C3CC(C)C(OC(=O)c4ccccc4)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.70 |