Drugs present in MMsINC which are similar to the molecule MMscode: MMs02164036
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.82 |
MMs01725727 | ClC1(Cl)CC1c1ccc(OC(C(O)=O)(C)C)cc1 | 0.80 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.78 |
MMs01725135 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.76 |
MMs01724757 | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.76 |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.74 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.74 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.72 |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.71 |
MMs01727365 | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.71 |