Drugs present in MMsINC which are similar to the molecule MMscode: MMs02161846
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724855![]() | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.76 |
MMs01725751![]() | Clc1cc(ccc1OCC=C)CC(O)=O | 0.76 |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.76 |
MMs01726736![]() | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.75 |
MMs01724737![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.71 |
MMs01725786![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.71 |
MMs01724731![]() | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.70 |