Drugs present in MMsINC which are similar to the molecule MMscode: MMs02124445
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725374 | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.77 |
MMs01724736 | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.77 |
MMs01724989 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.77 |
MMs01724870 | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.77 |
MMs01724951 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.76 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.76 |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.70 |