Drugs present in MMsINC which are similar to the molecule MMscode: MMs02113851
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725775 | Clc1cc(-c2cc(Cl)cc([N+](=O)[O-])c2O)c(O)c([N+](=O)[O-])c1 | 0.73 |
MMs01725192 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.72 |
MMs01725202 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.72 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.72 |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.71 |