Drugs present in MMsINC which are similar to the molecule MMscode: MMs02110142
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725309![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.81 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.81 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.81 |
MMs01724873![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.75 |
MMs01725745![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.75 |
MMs01725747![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.75 |
MMs01725749![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.75 |
MMs01725773![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.72 |
MMs01725538![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.72 |
MMs01725828![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.72 |
MMs01727287![]() | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.72 |
MMs01725782![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01725784![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01726673![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.71 |
MMs01725949![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.71 |
MMs01726669![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.71 |
MMs01726671![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.71 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.71 |
MMs01724888![]() | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.71 |
MMs01727470![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.71 |
MMs01727472![]() | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.71 |