Drugs present in MMsINC which are similar to the molecule MMscode: MMs02098978
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726784 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.77 |
MMs01726782 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.77 |
MMs01725796 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.76 |
MMs01724792 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.76 |
MMs01727428 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(S(=O)(=O)N(C)C)cc2 | 0.75 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.74 |
MMs01724782 | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.73 |
MMs01725055 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.70 |
MMs01725438 | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.70 |