Drugs present in MMsINC which are similar to the molecule MMscode: MMs02097900
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726775 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)CCOC(=O)CCCCCC)cc(cc2)C(F)(F)F | 0.73 |
MMs01725193 | S(=O)(=O)(CC(O)(C(=O)Nc1cc(C(F)(F)F)c(cc1)C#N)C)c1ccc(F)cc1 | 0.71 |
MMs01725378 | S(=O)(=O)(CC(O)(C(=O)Nc1cc(C(F)(F)F)c(cc1)C#N)C)c1ccc(F)cc1 | 0.71 |
MMs01724810 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.71 |
MMs01725177 | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(SCC)cc2 | 0.71 |
MMs01725055 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.70 |