Drugs present in MMsINC which are similar to the molecule MMscode: MMs02083999
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.74 |
MMs01725438 | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.71 |
MMs01727141 | O=C1N(c2c(cc([N+](=O)[O-])cc2)C(=NC1)c1ccccc1)C | 0.71 |
MMs01724792 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.71 |
MMs01725796 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.71 |