Drugs present in MMsINC which are similar to the molecule MMscode: MMs02059139
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727045![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.85 |
MMs01727043![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.85 |
MMs01727049![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.85 |
MMs01727047![]() | O(C)c1cc2CC(N(Cc2cc1OC)C(=O)C(NC(CCc1ccccc1)C(OCC)=O)C)C(O)=O | 0.85 |
MMs01725187![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.74 |
MMs01724825![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.73 |
MMs01724784![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.73 |
MMs01725143![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.73 |
MMs01725755![]() | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.73 |
MMs01724821![]() | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.73 |
MMs01725517![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.71 |
MMs01725388![]() | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.70 |