Drugs present in MMsINC which are similar to the molecule MMscode: MMs02056493
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.71 |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.71 |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.71 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.71 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.70 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.70 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.70 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.70 |