Drugs present in MMsINC which are similar to the molecule MMscode: MMs02052094
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727511![]() | O(C(=O)C(CO)c1ccccc1)C1CC2[N+](C(C1)CC2)(Cc1ccc(OCCCC)cc1)C | 0.77 |
MMs01727365![]() | O(CC(O)=O)c1cc(OCC=C(C)C)ccc1C(=O)\C=C\c1ccc(OCC=C(C)C)cc1 | 0.76 |
MMs01727463![]() | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.74 |
MMs01725781![]() | O1c2c(C(=O)C(O)C1c1cc3OC(C(Oc3cc1)CO)c1cc(OC)c(O)cc1)c(O)cc(O)c2 | 0.73 |
MMs01725187![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.73 |
MMs01725423![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)CCC2=O | 0.73 |
MMs01724767![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |
MMs01725139![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |
MMs01725137![]() | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.72 |
MMs01725170![]() | s1c2c(ccc(O)c2)c(C(=O)c2ccc(OCCN3CCCCC3)cc2)c1-c1ccc(O)cc1 | 0.72 |
MMs01725128![]() | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2=O)CC=C | 0.72 |
MMs01727183![]() | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2=O)C | 0.72 |
MMs01727181![]() | O1C2C34CCN(C(Cc5c3c1c(OC)cc5)C4(O)CCC2=O)C | 0.72 |
MMs01725152![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)CCC2=O | 0.71 |