Drugs present in MMsINC which are similar to the molecule MMscode: MMs02049406
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.76 |
MMs01724851![]() | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.76 |
MMs01726730![]() | Clc1cc(N2CCN(CC2)CCCN2N=C(N(CC)C2=O)CC)ccc1 | 0.76 |
MMs01724853![]() | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.73 |
MMs01725237![]() | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.71 |
MMs01725215![]() | O=C1N(N=NN1CC)CCN1CCC(N(C(=O)CC)c2ccccc2)(CC1)COC | 0.71 |