Drugs present in MMsINC which are similar to the molecule MMscode: MMs02035550
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725721 | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.89 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.84 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.84 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.81 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.81 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.81 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.81 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.79 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.79 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.76 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.76 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.75 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.74 |
MMs01724772 | O1C(CNC1=O)COc1ccccc1OC | 0.74 |
MMs01725806 | O1C(CNC1=O)COc1ccccc1OC | 0.74 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.71 |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.71 |