Drugs present in MMsINC which are similar to the molecule MMscode: MMs02021672
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.73 |
MMs01725593![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.72 |
MMs01725592![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.72 |
MMs01724922![]() | s1c2c(cc1)C(c1c(CC2)cccc1)=C1CC[NH+](CC1)C | 0.72 |
MMs01726915![]() | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2C | 0.71 |
MMs01724937![]() | Clc1ccccc1C[NH+]1CCc2sccc2C1 | 0.71 |
MMs01724810![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.71 |
MMs01725321![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.71 |
MMs01727233![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727235![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727237![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |
MMs01727239![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NC(=O)N1CCN(CC)C(=O)C1=O)c1ccccc1 | 0.71 |