Drugs present in MMsINC which are similar to the molecule MMscode: MMs02014069
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724816 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.75 |
MMs01727112 | O(C(=O)CCc1ccccc1)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.71 |
MMs01727113 | O(C(=O)CCc1ccccc1)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.71 |
MMs01727114 | O(C(=O)CCc1ccccc1)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.71 |
MMs01727115 | O(C(=O)CCc1ccccc1)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.71 |