Drugs present in MMsINC which are similar to the molecule MMscode: MMs02011208
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724786 | O1CCN(CC1)CC1CCc2[nH]c(C)c(c2C1=O)CC | 0.80 |
MMs01725203 | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.75 |
MMs01725418 | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.75 |
MMs01726139 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.72 |
MMs01726143 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.72 |
MMs01726141 | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.72 |
MMs01726780 | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.72 |
MMs01725710 | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.72 |
MMs01726778 | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.72 |
MMs01725098 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.71 |
MMs01725416 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.71 |
MMs01724762 | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.71 |