Drugs present in MMsINC which are similar to the molecule MMscode: MMs01963631
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726139![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.88 |
MMs01726143![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.88 |
MMs01726141![]() | O=C(N(CCCN(C)C)C(=O)NCC)C1CC2C(N(C1)CC=C)Cc1c3c2cccc3[nH]c1 | 0.88 |
MMs01725141![]() | O=C(N(CC)CC)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1 | 0.78 |
MMs01725098![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.75 |
MMs01725416![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.75 |
MMs01724762![]() | O=C(NC1CC2N(C(C1)CCC2)C)c1nn(c2c1cccc2)C | 0.73 |
MMs01725449![]() | OC(=O)C(NC(=O)c1ccc(N(Cc2nc3c(nc(nc3N)N)nc2)C)cc1)CCC(O)=O | 0.71 |
MMs01725790![]() | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.71 |











