Drugs present in MMsINC which are similar to the molecule MMscode: MMs01915957
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727349 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.80 |
MMs01725704 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.80 |
MMs01727347 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.80 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.70 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.70 |