Drugs present in MMsINC which are similar to the molecule MMscode: MMs01898559
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.75 |
MMs01725370![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.75 |
MMs01725593![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.73 |
MMs01725592![]() | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.73 |
MMs01725784![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01725782![]() | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725598![]() | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01725600![]() | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01725697![]() | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01725699![]() | ClC=1CCC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.72 |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.71 |
MMs01725524![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.71 |
MMs01725525![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.71 |
MMs01725235![]() | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725161![]() | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.71 |
MMs01725769![]() | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725242![]() | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.71 |
MMs01725017![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.71 |
MMs01725331![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.71 |
MMs01725308![]() | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.70 |
MMs01725018![]() | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.70 |
MMs01726385![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01726381![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01726383![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01725483![]() | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.70 |