Drugs present in MMsINC which are similar to the molecule MMscode: MMs01897453
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724978![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01725087![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01725185![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.73 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |