Drugs present in MMsINC which are similar to the molecule MMscode: MMs01868309
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.74 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.73 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.73 |
MMs01727455 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727449 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727451 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727453 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01726816 | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.70 |
MMs01726814 | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.70 |
MMs01726815 | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.70 |
MMs01726817 | O(C(=O)CC(O)(C1CCCC1)c1ccccc1)C1CC[N+](C1)(C)C | 0.70 |