Drugs present in MMsINC which are similar to the molecule MMscode: MMs01843250
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726884![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.73 |
MMs01726882![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.73 |
MMs01725840![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.73 |
MMs01726886![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.73 |
MMs01725691![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.73 |
MMs01725517![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.73 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.72 |
MMs01724802![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.71 |
MMs01725329![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.71 |
MMs01724780![]() | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01725116![]() | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01725342![]() | O(CC(O)CNC(C)(C)C)c1ccccc1C1CCCC1 | 0.70 |
MMs01724915![]() | O(CC(O)CNC(C)(C)C)c1ccccc1C1CCCC1 | 0.70 |