Drugs present in MMsINC which are similar to the molecule MMscode: MMs01835578
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.82 |
MMs01725830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.82 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.78 |
MMs01724733 | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.74 |
MMs01725723 | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.73 |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.72 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.72 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.72 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.72 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.71 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.71 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |