Drugs present in MMsINC which are similar to the molecule MMscode: MMs01826057
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725015 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.77 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.77 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01725292 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01726886 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01725361 | O1Cc2c(cccc2)/C(/c2cc(ccc12)CC(O)=O)=C\CCN(C)C | 0.71 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01726882 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01726884 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01725757 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725759 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725761 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725763 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.71 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.70 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.70 |