Drugs present in MMsINC which are similar to the molecule MMscode: MMs01820549
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725691![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.77 |
MMs01725517![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.77 |
MMs01726905![]() | Ic1cc(cc(I)c1Oc1cc(I)c(O)cc1)CC(N)C(O)=O | 0.75 |
MMs01725292![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01726904![]() | Ic1cc(cc(I)c1Oc1cc(I)c(O)c(I)c1)CC(N)C(O)=O | 0.74 |
MMs01726903![]() | Ic1cc(cc(I)c1Oc1cc(I)c(O)c(I)c1)CC(N)C(O)=O | 0.74 |
MMs01727511![]() | O(C(=O)C(CO)c1ccccc1)C1CC2[N+](C(C1)CC2)(Cc1ccc(OCCCC)cc1)C | 0.73 |
MMs01725619![]() | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.72 |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.71 |
MMs01725104![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.70 |
MMs01725015![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.70 |
MMs01725361![]() | O1Cc2c(cccc2)/C(/c2cc(ccc12)CC(O)=O)=C\CCN(C)C | 0.70 |