Drugs present in MMsINC which are similar to the molecule MMscode: MMs01797740
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724833![]() | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.88 |
MMs01726609![]() | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.74 |
MMs01725453![]() | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.71 |
MMs01725702![]() | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.71 |
MMs01726898![]() | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.71 |