Drugs present in MMsINC which are similar to the molecule MMscode: MMs01797326
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727463 | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.72 |
MMs01727513 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.71 |
MMs01727510 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.71 |
MMs01727512 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.71 |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.71 |
MMs01726500 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)C=CC2O | 0.71 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.71 |
MMs01726110 | O(C(=O)c1ccc(cc1)C)c1cc(ccc1OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C | 0.70 |