Drugs present in MMsINC which are similar to the molecule MMscode: MMs01796660
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725262 | O1c2c(cccc2C(OCCN2CCCCC2)=O)C(=O)C(C)=C1c1ccccc1 | 0.72 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.72 |
MMs01725991 | Ic1cc(cc(I)c1OCCN(CC)CC)C(=O)c1c2c(oc1CCCC)cccc2 | 0.71 |
MMs01725590 | O1Cc2c(c(O)c(C\C=C(\CCC(OCCN3CCOCC3)=O)/C)c(OC)c2C)C1=O | 0.71 |
MMs01724825 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.71 |
MMs01725929 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.71 |