Drugs present in MMsINC which are similar to the molecule MMscode: MMs01791054
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727726![]() | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.72 |
MMs01727723![]() | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.72 |
MMs01727724![]() | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.72 |
MMs01727725![]() | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.72 |
MMs01727686![]() | O(C(=O)CCCCCCCCC)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.72 |
MMs01727687![]() | O(C(=O)CCCCCCCCC)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.72 |
MMs01727688![]() | O(C(=O)CCCCCCCCC)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.72 |
MMs01727689![]() | O(C(=O)CCCCCCCCC)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.72 |