Drugs present in MMsINC which are similar to the molecule MMscode: MMs01771635
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726609![]() | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.72 |
MMs01727015![]() | Ic1c(C(O)=O)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.71 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.70 |
MMs01724790![]() | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.70 |
MMs01725317![]() | OCc1cc2CCC(Nc2cc1[N+](=O)[O-])CNC(C)C | 0.70 |