Drugs present in MMsINC which are similar to the molecule MMscode: MMs01762277
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725691 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.80 |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.80 |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.77 |
MMs01725947 | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.71 |
MMs01726922 | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.71 |
MMs01725282 | O(C(=O)c1ccc(cc1)C)c1cc(ccc1OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C | 0.71 |
MMs01726110 | O(C(=O)c1ccc(cc1)C)c1cc(ccc1OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C | 0.71 |