Drugs present in MMsINC which are similar to the molecule MMscode: MMs01760625
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.77 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.77 |
MMs01725048 | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.72 |
MMs01727224 | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.72 |
MMs01725723 | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.70 |
MMs01725943 | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.70 |