Drugs present in MMsINC which are similar to the molecule MMscode: MMs01733230
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.72 |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.72 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.71 |
MMs01724795 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.70 |
MMs01724769 | Clc1ccc(cc1)C1(O)N2C(=NCC2)c2c1cccc2 | 0.70 |