Drugs present in MMsINC which are similar to the molecule MMscode: MMs01727216
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727063![]() | S(C(=O)C(NC(=O)C1CCCCC1)C)CC(C(=O)N1CCCC1C(O)=O)C | 0.75 |
MMs01727069![]() | S(C(=O)C(NC(=O)C1CCCCC1)C)CC(C(=O)N1CCCC1C(O)=O)C | 0.75 |
MMs01727067![]() | S(C(=O)C(NC(=O)C1CCCCC1)C)CC(C(=O)N1CCCC1C(O)=O)C | 0.75 |
MMs01727065![]() | S(C(=O)C(NC(=O)C1CCCCC1)C)CC(C(=O)N1CCCC1C(O)=O)C | 0.75 |
MMs01727455![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.71 |
MMs01727449![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.71 |
MMs01727451![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.71 |
MMs01727453![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.71 |
MMs01726478![]() | ClC(C(NC(=O)C1N(CC(C1)CCC)C)C1OC(SC)C(O)C(O)C1O)C | 0.71 |
MMs01726484![]() | ClC(C(NC(=O)C1N(CC(C1)CCC)C)C1OC(SC)C(O)C(O)C1O)C | 0.71 |
MMs01726482![]() | ClC(C(NC(=O)C1N(CC(C1)CCC)C)C1OC(SC)C(O)C(O)C1O)C | 0.71 |
MMs01726480![]() | ClC(C(NC(=O)C1N(CC(C1)CCC)C)C1OC(SC)C(O)C(O)C1O)C | 0.71 |